C14H9F3N3O4S- — CID 8826155
5-[(Z)-C-methyl-N-[2-nitro-4-(trifluoromethyl)anilino]carbonimidoyl]thiophene-2-carboxylate (PubChem CID 8826155) has the molecular formula C14H9F3N3O4S- and a molecular weight of 372.30 g/mol. Its IUPAC name is 5-[(Z)-C-methyl-N-[2-nitro-4-(trifluoromethyl)anilino]carbonimidoyl]thiophene-2-carboxylate.
| Compound Name | 5-[(Z)-C-methyl-N-[2-nitro-4-(trifluoromethyl)anilino]carbonimidoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 8826155 |
| Molecular Formula | C14H9F3N3O4S- |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 5-[(Z)-C-methyl-N-[2-nitro-4-(trifluoromethyl)anilino]carbonimidoyl]thiophene-2-carboxylate |
| SMILES | C/C(=N/Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1ccc(C(=O)[O-])s1 |
| InChI | InChI=1S/C14H10F3N3O4S/c1-7(11-4-5-12(25-11)13(21)22)18-19-9-3-2-8(14(15,16)17)6-10(9)20(23)24/h2-6,19H,1H3,(H,21,22)/p-1/b18-7- |
| InChIKey | FXAFUHOZLCMEQL-WSVATBPTSA-M |
| XLogP | 2.87 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|