C19H18F3N5O4 — CID 6516323
ethyl (2E,3Z)-3-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]-2-(phenylhydrazinylidene)butanoate (PubChem CID 6516323) has the molecular formula C19H18F3N5O4 and a molecular weight of 437.38 g/mol. Its IUPAC name is ethyl (2E,3Z)-3-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]-2-(phenylhydrazinylidene)butanoate.
| Compound Name | ethyl (2E,3Z)-3-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]-2-(phenylhydrazinylidene)butanoate |
|---|---|
| PubChem CID | 6516323 |
| Molecular Formula | C19H18F3N5O4 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | ethyl (2E,3Z)-3-[[2-nitro-4-(trifluoromethyl)phenyl]hydrazinylidene]-2-(phenylhydrazinylidene)butanoate |
| SMILES | CCOC(=O)C(=N/Nc1ccccc1)/C(C)=N\Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18F3N5O4/c1-3-31-18(28)17(26-24-14-7-5-4-6-8-14)12(2)23-25-15-10-9-13(19(20,21)22)11-16(15)27(29)30/h4-11,24-25H,3H2,1-2H3/b23-12-,26-17+ |
| InChIKey | CHONSYOZAGPDFE-KRUVQQTLSA-N |
| XLogP | 4.43 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|