C13H17N5O2S — CID 98518108
ethyl (2Z,3E)-3-(carbamothioylhydrazinylidene)-2-(phenylhydrazinylidene)butanoate (PubChem CID 98518108) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is ethyl (2Z,3E)-3-(carbamothioylhydrazinylidene)-2-(phenylhydrazinylidene)butanoate.
| Compound Name | ethyl (2Z,3E)-3-(carbamothioylhydrazinylidene)-2-(phenylhydrazinylidene)butanoate |
|---|---|
| PubChem CID | 98518108 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | ethyl (2Z,3E)-3-(carbamothioylhydrazinylidene)-2-(phenylhydrazinylidene)butanoate |
| SMILES | CCOC(=O)C(=N\Nc1ccccc1)/C(C)=N/NC(N)=S |
| InChI | InChI=1S/C13H17N5O2S/c1-3-20-12(19)11(9(2)15-18-13(14)21)17-16-10-7-5-4-6-8-10/h4-8,16H,3H2,1-2H3,(H3,14,18,21)/b15-9+,17-11- |
| InChIKey | MWWUZDSDENCAHF-OZFFNSMRSA-N |
| XLogP | 1.23 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|