C13H15Cl2N5O2S — CID 6413876
ethyl (2Z,3Z)-3-(carbamothioylhydrazinylidene)-2-[(2,4-dichlorophenyl)hydrazinylidene]butanoate (PubChem CID 6413876) has the molecular formula C13H15Cl2N5O2S and a molecular weight of 376.27 g/mol. Its IUPAC name is ethyl (2Z,3Z)-3-(carbamothioylhydrazinylidene)-2-[(2,4-dichlorophenyl)hydrazinylidene]butanoate.
| Compound Name | ethyl (2Z,3Z)-3-(carbamothioylhydrazinylidene)-2-[(2,4-dichlorophenyl)hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 6413876 |
| Molecular Formula | C13H15Cl2N5O2S |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | ethyl (2Z,3Z)-3-(carbamothioylhydrazinylidene)-2-[(2,4-dichlorophenyl)hydrazinylidene]butanoate |
| SMILES | CCOC(=O)C(=N\Nc1ccc(Cl)cc1Cl)/C(C)=N\NC(N)=S |
| InChI | InChI=1S/C13H15Cl2N5O2S/c1-3-22-12(21)11(7(2)17-20-13(16)23)19-18-10-5-4-8(14)6-9(10)15/h4-6,18H,3H2,1-2H3,(H3,16,20,23)/b17-7-,19-11- |
| InChIKey | BBBIFIYFCMQMRF-BVUGDJLUSA-N |
| XLogP | 2.53 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|