C14H19N5O3S — CID 98518100
ethyl (2E,3Z)-3-(carbamothioylhydrazinylidene)-2-[(2-methoxyphenyl)hydrazinylidene]butanoate (PubChem CID 98518100) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is ethyl (2E,3Z)-3-(carbamothioylhydrazinylidene)-2-[(2-methoxyphenyl)hydrazinylidene]butanoate.
| Compound Name | ethyl (2E,3Z)-3-(carbamothioylhydrazinylidene)-2-[(2-methoxyphenyl)hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 98518100 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | ethyl (2E,3Z)-3-(carbamothioylhydrazinylidene)-2-[(2-methoxyphenyl)hydrazinylidene]butanoate |
| SMILES | CCOC(=O)C(=N/Nc1ccccc1OC)/C(C)=N\NC(N)=S |
| InChI | InChI=1S/C14H19N5O3S/c1-4-22-13(20)12(9(2)16-19-14(15)23)18-17-10-7-5-6-8-11(10)21-3/h5-8,17H,4H2,1-3H3,(H3,15,19,23)/b16-9-,18-12+ |
| InChIKey | ISGQSKKETVMDNQ-YHGCOBMBSA-N |
| XLogP | 1.24 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|