C13H16N6O4S — CID 6413874
ethyl (2Z,3Z)-3-(carbamothioylhydrazinylidene)-2-[(2-nitrophenyl)hydrazinylidene]butanoate (PubChem CID 6413874) has the molecular formula C13H16N6O4S and a molecular weight of 352.38 g/mol. Its IUPAC name is ethyl (2Z,3Z)-3-(carbamothioylhydrazinylidene)-2-[(2-nitrophenyl)hydrazinylidene]butanoate.
| Compound Name | ethyl (2Z,3Z)-3-(carbamothioylhydrazinylidene)-2-[(2-nitrophenyl)hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 6413874 |
| Molecular Formula | C13H16N6O4S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | ethyl (2Z,3Z)-3-(carbamothioylhydrazinylidene)-2-[(2-nitrophenyl)hydrazinylidene]butanoate |
| SMILES | CCOC(=O)C(=N\Nc1ccccc1[N+](=O)[O-])/C(C)=N\NC(N)=S |
| InChI | InChI=1S/C13H16N6O4S/c1-3-23-12(20)11(8(2)15-18-13(14)24)17-16-9-6-4-5-7-10(9)19(21)22/h4-7,16H,3H2,1-2H3,(H3,14,18,24)/b15-8-,17-11- |
| InChIKey | YSMFWADPTZZFEI-QTZOOJAOSA-N |
| XLogP | 1.13 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|