C15H21N5O2S — CID 98518090
ethyl (2Z,3E)-3-(carbamothioylhydrazinylidene)-2-[(2,4-dimethylphenyl)hydrazinylidene]butanoate (PubChem CID 98518090) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is ethyl (2Z,3E)-3-(carbamothioylhydrazinylidene)-2-[(2,4-dimethylphenyl)hydrazinylidene]butanoate.
| Compound Name | ethyl (2Z,3E)-3-(carbamothioylhydrazinylidene)-2-[(2,4-dimethylphenyl)hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 98518090 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | ethyl (2Z,3E)-3-(carbamothioylhydrazinylidene)-2-[(2,4-dimethylphenyl)hydrazinylidene]butanoate |
| SMILES | CCOC(=O)C(=N\Nc1ccc(C)cc1C)/C(C)=N/NC(N)=S |
| InChI | InChI=1S/C15H21N5O2S/c1-5-22-14(21)13(11(4)17-20-15(16)23)19-18-12-7-6-9(2)8-10(12)3/h6-8,18H,5H2,1-4H3,(H3,16,20,23)/b17-11+,19-13- |
| InChIKey | HCUAELPTSAHIDO-NJKWAXQJSA-N |
| XLogP | 1.84 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|