C16H23N3O3 — CID 3978310
ethyl 3-[[2-(2,4-dimethylanilino)acetyl]hydrazinylidene]butanoate (PubChem CID 3978310) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is ethyl 3-[[2-(2,4-dimethylanilino)acetyl]hydrazinylidene]butanoate.
| Compound Name | ethyl 3-[[2-(2,4-dimethylanilino)acetyl]hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 3978310 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | ethyl 3-[[2-(2,4-dimethylanilino)acetyl]hydrazinylidene]butanoate |
| SMILES | CCOC(=O)CC(C)=NNC(=O)CNc1ccc(C)cc1C |
| InChI | InChI=1S/C16H23N3O3/c1-5-22-16(21)9-13(4)18-19-15(20)10-17-14-7-6-11(2)8-12(14)3/h6-8,17H,5,9-10H2,1-4H3,(H,19,20) |
| InChIKey | JKRBHGARAZUAJV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|