C11H15NO2 — CID 28564487
methyl 2-(2,4-dimethylanilino)acetate (PubChem CID 28564487) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is methyl 2-(2,4-dimethylanilino)acetate.
| Compound Name | methyl 2-(2,4-dimethylanilino)acetate |
|---|---|
| PubChem CID | 28564487 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | methyl 2-(2,4-dimethylanilino)acetate |
| SMILES | COC(=O)CNc1ccc(C)cc1C |
| InChI | InChI=1S/C11H15NO2/c1-8-4-5-10(9(2)6-8)12-7-11(13)14-3/h4-6,12H,7H2,1-3H3 |
| InChIKey | SDVHTXFQJRASCB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |