methyl 2-(2-methoxy-3,5-dimethylanilino)acetate

C12H17NO3 — CID 115232671

IUPACmethyl 2-(2-methoxy-3,5-dimethylanilino)acetate
SMILESCOC(=O)CNc1cc(C)cc(C)c1OC
InChIInChI=1S/C12H17NO3/c1-8-5-9(2)12(16-4)10(6-8)13-7-11(14)15-3/h5-6,13H,7H2,1-4H3
InChIKeyFZCZVZDGFOLJOV-UHFFFAOYSA-N
MW223.27 g/mol
LogP1.90
Rot. Bonds4

About methyl 2-(2-methoxy-3,5-dimethylanilino)acetate

methyl 2-(2-methoxy-3,5-dimethylanilino)acetate (PubChem CID 115232671) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is methyl 2-(2-methoxy-3,5-dimethylanilino)acetate.

Molecular Properties

Compound Namemethyl 2-(2-methoxy-3,5-dimethylanilino)acetate
PubChem CID115232671
Molecular FormulaC12H17NO3
Molecular Weight223.27 g/mol
Exact Mass223.12
IUPAC Namemethyl 2-(2-methoxy-3,5-dimethylanilino)acetate
SMILESCOC(=O)CNc1cc(C)cc(C)c1OC
InChIInChI=1S/C12H17NO3/c1-8-5-9(2)12(16-4)10(6-8)13-7-11(14)15-3/h5-6,13H,7H2,1-4H3
InChIKeyFZCZVZDGFOLJOV-UHFFFAOYSA-N
XLogP1.90
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.27
LogP ≤ 51.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-(2-methoxy-3,5-dimethylanilino)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2-methoxy-3,5-dimethylanilino)acetate?
The IUPAC name of methyl 2-(2-methoxy-3,5-dimethylanilino)acetate (CID 115232671) is methyl 2-(2-methoxy-3,5-dimethylanilino)acetate.
What is the SMILES notation for methyl 2-(2-methoxy-3,5-dimethylanilino)acetate?
The canonical SMILES for methyl 2-(2-methoxy-3,5-dimethylanilino)acetate is COC(=O)CNc1cc(C)cc(C)c1OC.
What is the InChIKey of methyl 2-(2-methoxy-3,5-dimethylanilino)acetate?
The InChIKey is FZCZVZDGFOLJOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3/c1-8-5-9(2)12(16-4)10(6-8)13-7-11(14)15-3/h5-6,13H,7H2,1-4H3.
What are the key properties of methyl 2-(2-methoxy-3,5-dimethylanilino)acetate?
methyl 2-(2-methoxy-3,5-dimethylanilino)acetate has a molecular weight of 223.27 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-methoxy-3,5-dimethylanilino)acetate is sourced from PubChem (CID 115232671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).