C18H21NO6S — CID 22304151
methyl 2-[2,5-dimethoxy-3-(4-methylphenyl)sulfonylanilino]acetate (PubChem CID 22304151) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is methyl 2-[2,5-dimethoxy-3-(4-methylphenyl)sulfonylanilino]acetate.
| Compound Name | methyl 2-[2,5-dimethoxy-3-(4-methylphenyl)sulfonylanilino]acetate |
|---|---|
| PubChem CID | 22304151 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | methyl 2-[2,5-dimethoxy-3-(4-methylphenyl)sulfonylanilino]acetate |
| SMILES | COC(=O)CNc1cc(OC)cc(S(=O)(=O)c2ccc(C)cc2)c1OC |
| InChI | InChI=1S/C18H21NO6S/c1-12-5-7-14(8-6-12)26(21,22)16-10-13(23-2)9-15(18(16)25-4)19-11-17(20)24-3/h5-10,19H,11H2,1-4H3 |
| InChIKey | JJNOJFIOCFYPGT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |