C18H21NO5S — CID 22304005
methyl 2-[2-ethoxy-3-(4-methylphenyl)sulfonylanilino]acetate (PubChem CID 22304005) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is methyl 2-[2-ethoxy-3-(4-methylphenyl)sulfonylanilino]acetate.
| Compound Name | methyl 2-[2-ethoxy-3-(4-methylphenyl)sulfonylanilino]acetate |
|---|---|
| PubChem CID | 22304005 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | methyl 2-[2-ethoxy-3-(4-methylphenyl)sulfonylanilino]acetate |
| SMILES | CCOc1c(NCC(=O)OC)cccc1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H21NO5S/c1-4-24-18-15(19-12-17(20)23-3)6-5-7-16(18)25(21,22)14-10-8-13(2)9-11-14/h5-11,19H,4,12H2,1-3H3 |
| InChIKey | KNQVCJVHAYOENS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |