C25H28N2O4S — CID 22304114
N-(2,6-dimethylphenyl)-2-[4-ethoxy-2-(4-methylphenyl)sulfonylanilino]acetamide (PubChem CID 22304114) has the molecular formula C25H28N2O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[4-ethoxy-2-(4-methylphenyl)sulfonylanilino]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[4-ethoxy-2-(4-methylphenyl)sulfonylanilino]acetamide |
|---|---|
| PubChem CID | 22304114 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-ethoxy-2-(4-methylphenyl)sulfonylanilino]acetamide |
| SMILES | CCOc1ccc(NCC(=O)Nc2c(C)cccc2C)c(S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C25H28N2O4S/c1-5-31-20-11-14-22(23(15-20)32(29,30)21-12-9-17(2)10-13-21)26-16-24(28)27-25-18(3)7-6-8-19(25)4/h6-15,26H,5,16H2,1-4H3,(H,27,28) |
| InChIKey | DEIFKOPDJTWDFK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|