C30H27ClF3N3O6S3 — CID 22305055
N-[4-[[4-chloro-3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2-[4-ethoxy-2-(4-methylsulfanylphenyl)sulfonylanilino]acetamide (PubChem CID 22305055) has the molecular formula C30H27ClF3N3O6S3 and a molecular weight of 714.21 g/mol. Its IUPAC name is N-[4-[[4-chloro-3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2-[4-ethoxy-2-(4-methylsulfanylphenyl)sulfonylanilino]acetamide.
| Compound Name | N-[4-[[4-chloro-3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2-[4-ethoxy-2-(4-methylsulfanylphenyl)sulfonylanilino]acetamide |
|---|---|
| PubChem CID | 22305055 |
| Molecular Formula | C30H27ClF3N3O6S3 |
| Molecular Weight | 714.21 g/mol |
| Exact Mass | 713.07 |
| IUPAC Name | N-[4-[[4-chloro-3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2-[4-ethoxy-2-(4-methylsulfanylphenyl)sulfonylanilino]acetamide |
| SMILES | CCOc1ccc(NCC(=O)Nc2ccc(S(=O)(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)c(S(=O)(=O)c2ccc(SC)cc2)c1 |
| InChI | InChI=1S/C30H27ClF3N3O6S3/c1-3-43-21-7-15-27(28(17-21)45(39,40)23-12-8-22(44-2)9-13-23)35-18-29(38)36-19-4-10-24(11-5-19)46(41,42)37-20-6-14-26(31)25(16-20)30(32,33)34/h4-17,35,37H,3,18H2,1-2H3,(H,36,38) |
| InChIKey | JJNHVTRJUHNPEO-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.21 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|