C15H13ClF3NO2S2 — CID 71038589
4-chloro-N-(4-ethylsulfanylphenyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 71038589) has the molecular formula C15H13ClF3NO2S2 and a molecular weight of 395.86 g/mol. Its IUPAC name is 4-chloro-N-(4-ethylsulfanylphenyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(4-ethylsulfanylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71038589 |
| Molecular Formula | C15H13ClF3NO2S2 |
| Molecular Weight | 395.86 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 4-chloro-N-(4-ethylsulfanylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCSc1ccc(NS(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H13ClF3NO2S2/c1-2-23-11-5-3-10(4-6-11)20-24(21,22)12-7-8-14(16)13(9-12)15(17,18)19/h3-9,20H,2H2,1H3 |
| InChIKey | YIHPGEVTOMDXSG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.86 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |