C13H7Cl2F3INO2S — CID 67972012
4-chloro-N-(5-chloro-2-iodophenyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 67972012) has the molecular formula C13H7Cl2F3INO2S and a molecular weight of 496.08 g/mol. Its IUPAC name is 4-chloro-N-(5-chloro-2-iodophenyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(5-chloro-2-iodophenyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 67972012 |
| Molecular Formula | C13H7Cl2F3INO2S |
| Molecular Weight | 496.08 g/mol |
| Exact Mass | 494.86 |
| IUPAC Name | 4-chloro-N-(5-chloro-2-iodophenyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)ccc1I)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H7Cl2F3INO2S/c14-7-1-4-11(19)12(5-7)20-23(21,22)8-2-3-10(15)9(6-8)13(16,17)18/h1-6,20H |
| InChIKey | YTTOQRGFNRVUJX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.08 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|