C14H7Cl2F4NO4S — CID 59303000
4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-5-fluorobenzoic acid (PubChem CID 59303000) has the molecular formula C14H7Cl2F4NO4S and a molecular weight of 432.18 g/mol. Its IUPAC name is 4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-5-fluorobenzoic acid.
| Compound Name | 4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 59303000 |
| Molecular Formula | C14H7Cl2F4NO4S |
| Molecular Weight | 432.18 g/mol |
| Exact Mass | 430.94 |
| IUPAC Name | 4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-5-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)c(Cl)cc1NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H7Cl2F4NO4S/c15-9-2-1-6(3-8(9)14(18,19)20)26(24,25)21-12-5-10(16)11(17)4-7(12)13(22)23/h1-5,21H,(H,22,23) |
| InChIKey | LETFDNZNRQJDTL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.18 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |