C13H7ClF5NO2S — CID 60585547
N-(4-chloro-2-fluorophenyl)-4-fluoro-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 60585547) has the molecular formula C13H7ClF5NO2S and a molecular weight of 371.71 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-4-fluoro-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-4-fluoro-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60585547 |
| Molecular Formula | C13H7ClF5NO2S |
| Molecular Weight | 371.71 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-4-fluoro-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1F)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H7ClF5NO2S/c14-7-1-4-12(11(16)5-7)20-23(21,22)8-2-3-10(15)9(6-8)13(17,18)19/h1-6,20H |
| InChIKey | NVHJPGUPAFITRI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.71 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |