C14H10BrClF3NO2S — CID 98000667
4-bromo-N-(5-chloro-2-methylphenyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 98000667) has the molecular formula C14H10BrClF3NO2S and a molecular weight of 428.66 g/mol. Its IUPAC name is 4-bromo-N-(5-chloro-2-methylphenyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-(5-chloro-2-methylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 98000667 |
| Molecular Formula | C14H10BrClF3NO2S |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 426.93 |
| IUPAC Name | 4-bromo-N-(5-chloro-2-methylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1ccc(Cl)cc1NS(=O)(=O)c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10BrClF3NO2S/c1-8-2-3-9(16)6-13(8)20-23(21,22)10-4-5-12(15)11(7-10)14(17,18)19/h2-7,20H,1H3 |
| InChIKey | JDZVHGBBPXSKJF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |