C15H13BrF3NO2S — CID 98000614
4-bromo-N-(2,5-dimethylphenyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 98000614) has the molecular formula C15H13BrF3NO2S and a molecular weight of 408.24 g/mol. Its IUPAC name is 4-bromo-N-(2,5-dimethylphenyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-(2,5-dimethylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 98000614 |
| Molecular Formula | C15H13BrF3NO2S |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | 4-bromo-N-(2,5-dimethylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1ccc(C)c(NS(=O)(=O)c2ccc(Br)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H13BrF3NO2S/c1-9-3-4-10(2)14(7-9)20-23(21,22)11-5-6-13(16)12(8-11)15(17,18)19/h3-8,20H,1-2H3 |
| InChIKey | RAJDXNMUECLCAZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |