C14H11ClF3NO4S2 — CID 14536176
4-chloro-N-(2-methylsulfonylphenyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 14536176) has the molecular formula C14H11ClF3NO4S2 and a molecular weight of 413.83 g/mol. Its IUPAC name is 4-chloro-N-(2-methylsulfonylphenyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(2-methylsulfonylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 14536176 |
| Molecular Formula | C14H11ClF3NO4S2 |
| Molecular Weight | 413.83 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | 4-chloro-N-(2-methylsulfonylphenyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccccc1NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11ClF3NO4S2/c1-24(20,21)13-5-3-2-4-12(13)19-25(22,23)9-6-7-11(15)10(8-9)14(16,17)18/h2-8,19H,1H3 |
| InChIKey | JOHLISGKRFLTDV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.83 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |