C13H9Cl2F3N2O3S — CID 67227108
4-chloro-N-(5-chloro-2-methoxy-3-pyridinyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 67227108) has the molecular formula C13H9Cl2F3N2O3S and a molecular weight of 401.19 g/mol. Its IUPAC name is 4-chloro-N-(5-chloro-2-methoxy-3-pyridinyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(5-chloro-2-methoxy-3-pyridinyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 67227108 |
| Molecular Formula | C13H9Cl2F3N2O3S |
| Molecular Weight | 401.19 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 4-chloro-N-(5-chloro-2-methoxy-3-pyridinyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1ncc(Cl)cc1NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H9Cl2F3N2O3S/c1-23-12-11(4-7(14)6-19-12)20-24(21,22)8-2-3-10(15)9(5-8)13(16,17)18/h2-6,20H,1H3 |
| InChIKey | MYBMWTLUVAOSOP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.19 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |