C20H17ClF3N3O4S — CID 167495752
N-[2-(4-amino-2-methoxyphenoxy)-5-methyl-3-pyridinyl]-4-chloro-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 167495752) has the molecular formula C20H17ClF3N3O4S and a molecular weight of 487.89 g/mol. Its IUPAC name is N-[2-(4-amino-2-methoxyphenoxy)-5-methyl-3-pyridinyl]-4-chloro-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-(4-amino-2-methoxyphenoxy)-5-methyl-3-pyridinyl]-4-chloro-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 167495752 |
| Molecular Formula | C20H17ClF3N3O4S |
| Molecular Weight | 487.89 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | N-[2-(4-amino-2-methoxyphenoxy)-5-methyl-3-pyridinyl]-4-chloro-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1cc(N)ccc1Oc1ncc(C)cc1NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17ClF3N3O4S/c1-11-7-16(19(26-10-11)31-17-6-3-12(25)8-18(17)30-2)27-32(28,29)13-4-5-15(21)14(9-13)20(22,23)24/h3-10,27H,25H2,1-2H3 |
| InChIKey | XBURHTHSSCDLLZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.89 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|