C14H10ClF3N2O4S — CID 90105320
4-chloro-N-(5-formyl-2-methoxy-3-pyridinyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 90105320) has the molecular formula C14H10ClF3N2O4S and a molecular weight of 394.76 g/mol. Its IUPAC name is 4-chloro-N-(5-formyl-2-methoxy-3-pyridinyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(5-formyl-2-methoxy-3-pyridinyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90105320 |
| Molecular Formula | C14H10ClF3N2O4S |
| Molecular Weight | 394.76 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 4-chloro-N-(5-formyl-2-methoxy-3-pyridinyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1ncc(C=O)cc1NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10ClF3N2O4S/c1-24-13-12(4-8(7-21)6-19-13)20-25(22,23)9-2-3-11(15)10(5-9)14(16,17)18/h2-7,20H,1H3 |
| InChIKey | IAQQGTLZASFRFV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.76 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|