C20H14Cl2F3N3O3S — CID 143262645
4-chloro-N-[5-chloro-2-[2-(methylamino)benzoyl]-3-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 143262645) has the molecular formula C20H14Cl2F3N3O3S and a molecular weight of 504.32 g/mol. Its IUPAC name is 4-chloro-N-[5-chloro-2-[2-(methylamino)benzoyl]-3-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[5-chloro-2-[2-(methylamino)benzoyl]-3-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 143262645 |
| Molecular Formula | C20H14Cl2F3N3O3S |
| Molecular Weight | 504.32 g/mol |
| Exact Mass | 503.01 |
| IUPAC Name | 4-chloro-N-[5-chloro-2-[2-(methylamino)benzoyl]-3-pyridinyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CNc1ccccc1C(=O)c1ncc(Cl)cc1NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H14Cl2F3N3O3S/c1-26-16-5-3-2-4-13(16)19(29)18-17(8-11(21)10-27-18)28-32(30,31)12-6-7-15(22)14(9-12)20(23,24)25/h2-10,26,28H,1H3 |
| InChIKey | SJFGPKUJMOLUKO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.32 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|