C19H15Cl2N3O3S — CID 58268290
N-[2-(2-aminobenzoyl)-5-chloro-3-pyridinyl]-4-chloro-3-methylbenzenesulfonamide (PubChem CID 58268290) has the molecular formula C19H15Cl2N3O3S and a molecular weight of 436.32 g/mol. Its IUPAC name is N-[2-(2-aminobenzoyl)-5-chloro-3-pyridinyl]-4-chloro-3-methylbenzenesulfonamide.
| Compound Name | N-[2-(2-aminobenzoyl)-5-chloro-3-pyridinyl]-4-chloro-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 58268290 |
| Molecular Formula | C19H15Cl2N3O3S |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | N-[2-(2-aminobenzoyl)-5-chloro-3-pyridinyl]-4-chloro-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2cc(Cl)cnc2C(=O)c2ccccc2N)ccc1Cl |
| InChI | InChI=1S/C19H15Cl2N3O3S/c1-11-8-13(6-7-15(11)21)28(26,27)24-17-9-12(20)10-23-18(17)19(25)14-4-2-3-5-16(14)22/h2-10,24H,22H2,1H3 |
| InChIKey | SZLVPTUDOVIBDD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|