C23H20ClN2O5S- — CID 143610397
2-[3-[(4-tert-butylphenyl)sulfonylamino]-5-chloropyridine-2-carbonyl]benzoate (PubChem CID 143610397) has the molecular formula C23H20ClN2O5S- and a molecular weight of 471.94 g/mol. Its IUPAC name is 2-[3-[(4-tert-butylphenyl)sulfonylamino]-5-chloropyridine-2-carbonyl]benzoate.
| Compound Name | 2-[3-[(4-tert-butylphenyl)sulfonylamino]-5-chloropyridine-2-carbonyl]benzoate |
|---|---|
| PubChem CID | 143610397 |
| Molecular Formula | C23H20ClN2O5S- |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 2-[3-[(4-tert-butylphenyl)sulfonylamino]-5-chloropyridine-2-carbonyl]benzoate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2cc(Cl)cnc2C(=O)c2ccccc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C23H21ClN2O5S/c1-23(2,3)14-8-10-16(11-9-14)32(30,31)26-19-12-15(24)13-25-20(19)21(27)17-6-4-5-7-18(17)22(28)29/h4-13,26H,1-3H3,(H,28,29)/p-1 |
| InChIKey | NHSQTHOKHTVDEP-UHFFFAOYSA-M |
| XLogP | 3.43 |
| TPSA | 116.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |