C20H22ClN5O3S — CID 59428132
N-[1-[3-[(4-tert-butylphenyl)sulfonylamino]-5-chloro-2-pyridinyl]pyrazol-4-yl]acetamide (PubChem CID 59428132) has the molecular formula C20H22ClN5O3S and a molecular weight of 447.95 g/mol. Its IUPAC name is N-[1-[3-[(4-tert-butylphenyl)sulfonylamino]-5-chloro-2-pyridinyl]pyrazol-4-yl]acetamide.
| Compound Name | N-[1-[3-[(4-tert-butylphenyl)sulfonylamino]-5-chloro-2-pyridinyl]pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 59428132 |
| Molecular Formula | C20H22ClN5O3S |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | N-[1-[3-[(4-tert-butylphenyl)sulfonylamino]-5-chloro-2-pyridinyl]pyrazol-4-yl]acetamide |
| SMILES | CC(=O)Nc1cnn(-c2ncc(Cl)cc2NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C20H22ClN5O3S/c1-13(27)24-16-11-23-26(12-16)19-18(9-15(21)10-22-19)25-30(28,29)17-7-5-14(6-8-17)20(2,3)4/h5-12,25H,1-4H3,(H,24,27) |
| InChIKey | GWNCTGWBVLTORB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |