C15H16BClN2O2S — CID 88909110
CID 88909110 (PubChem CID 88909110) has the molecular formula C15H16BClN2O2S and a molecular weight of 334.64 g/mol.
| Compound Name | CID 88909110 |
|---|---|
| PubChem CID | 88909110 |
| Molecular Formula | C15H16BClN2O2S |
| Molecular Weight | 334.64 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | — |
| SMILES | [B]c1ncc(Cl)cc1NS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H16BClN2O2S/c1-15(2,3)10-4-6-12(7-5-10)22(20,21)19-13-8-11(17)9-18-14(13)16/h4-9,19H,1-3H3 |
| InChIKey | DCTHBFPENJUFLT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.64 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|