C17H22N4O3S — CID 59216834
4-tert-butyl-N-[2-(hydrazinecarbonyl)-5-methyl-3-pyridinyl]benzenesulfonamide (PubChem CID 59216834) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(hydrazinecarbonyl)-5-methyl-3-pyridinyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[2-(hydrazinecarbonyl)-5-methyl-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59216834 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 4-tert-butyl-N-[2-(hydrazinecarbonyl)-5-methyl-3-pyridinyl]benzenesulfonamide |
| SMILES | Cc1cnc(C(=O)NN)c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C17H22N4O3S/c1-11-9-14(15(19-10-11)16(22)20-18)21-25(23,24)13-7-5-12(6-8-13)17(2,3)4/h5-10,21H,18H2,1-4H3,(H,20,22) |
| InChIKey | GNARFYHHHUDZER-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|