C17H18Cl2N2O3S — CID 2856958
5-[(4-tert-butylphenyl)sulfonylamino]-2,4-dichlorobenzamide (PubChem CID 2856958) has the molecular formula C17H18Cl2N2O3S and a molecular weight of 401.32 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)sulfonylamino]-2,4-dichlorobenzamide.
| Compound Name | 5-[(4-tert-butylphenyl)sulfonylamino]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 2856958 |
| Molecular Formula | C17H18Cl2N2O3S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 5-[(4-tert-butylphenyl)sulfonylamino]-2,4-dichlorobenzamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2cc(C(N)=O)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H18Cl2N2O3S/c1-17(2,3)10-4-6-11(7-5-10)25(23,24)21-15-8-12(16(20)22)13(18)9-14(15)19/h4-9,21H,1-3H3,(H2,20,22) |
| InChIKey | MNEBERPLCQDUHY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |