C22H18ClN3O5S — CID 36525734
5-[[4-[(4-acetylphenyl)sulfonylamino]benzoyl]amino]-2-chlorobenzamide (PubChem CID 36525734) has the molecular formula C22H18ClN3O5S and a molecular weight of 471.92 g/mol. Its IUPAC name is 5-[[4-[(4-acetylphenyl)sulfonylamino]benzoyl]amino]-2-chlorobenzamide.
| Compound Name | 5-[[4-[(4-acetylphenyl)sulfonylamino]benzoyl]amino]-2-chlorobenzamide |
|---|---|
| PubChem CID | 36525734 |
| Molecular Formula | C22H18ClN3O5S |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 5-[[4-[(4-acetylphenyl)sulfonylamino]benzoyl]amino]-2-chlorobenzamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)Nc2ccc(C(=O)Nc3ccc(Cl)c(C(N)=O)c3)cc2)cc1 |
| InChI | InChI=1S/C22H18ClN3O5S/c1-13(27)14-4-9-18(10-5-14)32(30,31)26-16-6-2-15(3-7-16)22(29)25-17-8-11-20(23)19(12-17)21(24)28/h2-12,26H,1H3,(H2,24,28)(H,25,29) |
| InChIKey | DMLPACYWLWKEET-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |