C22H19ClN2O5S — CID 28573562
ethyl 5-[[4-(benzenesulfonamido)benzoyl]amino]-2-chlorobenzoate (PubChem CID 28573562) has the molecular formula C22H19ClN2O5S and a molecular weight of 458.92 g/mol. Its IUPAC name is ethyl 5-[[4-(benzenesulfonamido)benzoyl]amino]-2-chlorobenzoate.
| Compound Name | ethyl 5-[[4-(benzenesulfonamido)benzoyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 28573562 |
| Molecular Formula | C22H19ClN2O5S |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | ethyl 5-[[4-(benzenesulfonamido)benzoyl]amino]-2-chlorobenzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2)ccc1Cl |
| InChI | InChI=1S/C22H19ClN2O5S/c1-2-30-22(27)19-14-17(12-13-20(19)23)24-21(26)15-8-10-16(11-9-15)25-31(28,29)18-6-4-3-5-7-18/h3-14,25H,2H2,1H3,(H,24,26) |
| InChIKey | WDOAXXOBORHGBB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |