C23H20Cl2N2O5S — CID 92672233
ethyl 2-chloro-5-[[4-chloro-3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]benzoate (PubChem CID 92672233) has the molecular formula C23H20Cl2N2O5S and a molecular weight of 507.40 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[4-chloro-3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[4-chloro-3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 92672233 |
| Molecular Formula | C23H20Cl2N2O5S |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | ethyl 2-chloro-5-[[4-chloro-3-[(4-methylphenyl)sulfamoyl]benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)c2ccc(Cl)c(S(=O)(=O)Nc3ccc(C)cc3)c2)ccc1Cl |
| InChI | InChI=1S/C23H20Cl2N2O5S/c1-3-32-23(29)18-13-17(9-11-19(18)24)26-22(28)15-6-10-20(25)21(12-15)33(30,31)27-16-7-4-14(2)5-8-16/h4-13,27H,3H2,1-2H3,(H,26,28) |
| InChIKey | MYORVHIROJYETL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |