C26H22N2O5S2 — CID 121043595
ethyl 3-[[4-(benzenesulfonamido)benzoyl]amino]-5-phenylthiophene-2-carboxylate (PubChem CID 121043595) has the molecular formula C26H22N2O5S2 and a molecular weight of 506.61 g/mol. Its IUPAC name is ethyl 3-[[4-(benzenesulfonamido)benzoyl]amino]-5-phenylthiophene-2-carboxylate.
| Compound Name | ethyl 3-[[4-(benzenesulfonamido)benzoyl]amino]-5-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 121043595 |
| Molecular Formula | C26H22N2O5S2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | ethyl 3-[[4-(benzenesulfonamido)benzoyl]amino]-5-phenylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccccc2)cc1NC(=O)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22N2O5S2/c1-2-33-26(30)24-22(17-23(34-24)18-9-5-3-6-10-18)27-25(29)19-13-15-20(16-14-19)28-35(31,32)21-11-7-4-8-12-21/h3-17,28H,2H2,1H3,(H,27,29) |
| InChIKey | GQDXMXYQTMRKDY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |