C23H23ClN2O3S — CID 10094915
4-tert-butyl-N-[4-chloro-2-(3-methylpyridine-4-carbonyl)phenyl]benzenesulfonamide (PubChem CID 10094915) has the molecular formula C23H23ClN2O3S and a molecular weight of 442.97 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-chloro-2-(3-methylpyridine-4-carbonyl)phenyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[4-chloro-2-(3-methylpyridine-4-carbonyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10094915 |
| Molecular Formula | C23H23ClN2O3S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 4-tert-butyl-N-[4-chloro-2-(3-methylpyridine-4-carbonyl)phenyl]benzenesulfonamide |
| SMILES | Cc1cnccc1C(=O)c1cc(Cl)ccc1NS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H23ClN2O3S/c1-15-14-25-12-11-19(15)22(27)20-13-17(24)7-10-21(20)26-30(28,29)18-8-5-16(6-9-18)23(2,3)4/h5-14,26H,1-4H3 |
| InChIKey | HGWUASXEDDBFEE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|