C24H24ClN3O4S — CID 20827654
2-[4-[[4-chloro-2-(pyridine-4-carbonyl)phenyl]sulfamoyl]phenyl]-N,N,2-trimethylpropanamide (PubChem CID 20827654) has the molecular formula C24H24ClN3O4S and a molecular weight of 485.99 g/mol. Its IUPAC name is 2-[4-[[4-chloro-2-(pyridine-4-carbonyl)phenyl]sulfamoyl]phenyl]-N,N,2-trimethylpropanamide.
| Compound Name | 2-[4-[[4-chloro-2-(pyridine-4-carbonyl)phenyl]sulfamoyl]phenyl]-N,N,2-trimethylpropanamide |
|---|---|
| PubChem CID | 20827654 |
| Molecular Formula | C24H24ClN3O4S |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 2-[4-[[4-chloro-2-(pyridine-4-carbonyl)phenyl]sulfamoyl]phenyl]-N,N,2-trimethylpropanamide |
| SMILES | CN(C)C(=O)C(C)(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2C(=O)c2ccncc2)cc1 |
| InChI | InChI=1S/C24H24ClN3O4S/c1-24(2,23(30)28(3)4)17-5-8-19(9-6-17)33(31,32)27-21-10-7-18(25)15-20(21)22(29)16-11-13-26-14-12-16/h5-15,27H,1-4H3 |
| InChIKey | DORQWLQRKMCLIB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|