C21H16Cl2N2O3S — CID 88856886
N-[4-chloro-2-(6-chloropyridine-3-carbonyl)phenyl]-4-prop-1-en-2-ylbenzenesulfonamide (PubChem CID 88856886) has the molecular formula C21H16Cl2N2O3S and a molecular weight of 447.34 g/mol. Its IUPAC name is N-[4-chloro-2-(6-chloropyridine-3-carbonyl)phenyl]-4-prop-1-en-2-ylbenzenesulfonamide.
| Compound Name | N-[4-chloro-2-(6-chloropyridine-3-carbonyl)phenyl]-4-prop-1-en-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 88856886 |
| Molecular Formula | C21H16Cl2N2O3S |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | N-[4-chloro-2-(6-chloropyridine-3-carbonyl)phenyl]-4-prop-1-en-2-ylbenzenesulfonamide |
| SMILES | C=C(C)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2C(=O)c2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C21H16Cl2N2O3S/c1-13(2)14-3-7-17(8-4-14)29(27,28)25-19-9-6-16(22)11-18(19)21(26)15-5-10-20(23)24-12-15/h3-12,25H,1H2,2H3 |
| InChIKey | GRKADGNHQXCPIU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|