C19H14ClIN2O3S — CID 89372827
N-[4-chloro-2-(pyridine-3-carbonyl)phenyl]-4-(iodomethyl)benzenesulfonamide (PubChem CID 89372827) has the molecular formula C19H14ClIN2O3S and a molecular weight of 512.76 g/mol. Its IUPAC name is N-[4-chloro-2-(pyridine-3-carbonyl)phenyl]-4-(iodomethyl)benzenesulfonamide.
| Compound Name | N-[4-chloro-2-(pyridine-3-carbonyl)phenyl]-4-(iodomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 89372827 |
| Molecular Formula | C19H14ClIN2O3S |
| Molecular Weight | 512.76 g/mol |
| Exact Mass | 511.95 |
| IUPAC Name | N-[4-chloro-2-(pyridine-3-carbonyl)phenyl]-4-(iodomethyl)benzenesulfonamide |
| SMILES | O=C(c1cccnc1)c1cc(Cl)ccc1NS(=O)(=O)c1ccc(CI)cc1 |
| InChI | InChI=1S/C19H14ClIN2O3S/c20-15-5-8-18(17(10-15)19(24)14-2-1-9-22-12-14)23-27(25,26)16-6-3-13(11-21)4-7-16/h1-10,12,23H,11H2 |
| InChIKey | HDDPPCMRPPCKFJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.76 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|