C26H29ClN2O4S — CID 90942429
N-(2-benzoyl-4-chlorophenyl)-4-(morpholin-4-ylmethyl)benzenesulfonamide;ethane (PubChem CID 90942429) has the molecular formula C26H29ClN2O4S and a molecular weight of 501.05 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-4-(morpholin-4-ylmethyl)benzenesulfonamide;ethane.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-4-(morpholin-4-ylmethyl)benzenesulfonamide;ethane |
|---|---|
| PubChem CID | 90942429 |
| Molecular Formula | C26H29ClN2O4S |
| Molecular Weight | 501.05 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-4-(morpholin-4-ylmethyl)benzenesulfonamide;ethane |
| SMILES | CC.O=C(c1ccccc1)c1cc(Cl)ccc1NS(=O)(=O)c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C24H23ClN2O4S.C2H6/c25-20-8-11-23(22(16-20)24(28)19-4-2-1-3-5-19)26-32(29,30)21-9-6-18(7-10-21)17-27-12-14-31-15-13-27;1-2/h1-11,16,26H,12-15,17H2;1-2H3 |
| InChIKey | FUUJOSHSQXVOHA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.05 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|