C22H19ClFN3O5S — CID 24831315
N-[4-chloro-2-(1-oxidopyridin-1-ium-4-carbonyl)phenyl]-3-fluoro-4-morpholin-4-ylbenzenesulfonamide (PubChem CID 24831315) has the molecular formula C22H19ClFN3O5S and a molecular weight of 491.93 g/mol. Its IUPAC name is N-[4-chloro-2-(1-oxidopyridin-1-ium-4-carbonyl)phenyl]-3-fluoro-4-morpholin-4-ylbenzenesulfonamide.
| Compound Name | N-[4-chloro-2-(1-oxidopyridin-1-ium-4-carbonyl)phenyl]-3-fluoro-4-morpholin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 24831315 |
| Molecular Formula | C22H19ClFN3O5S |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | N-[4-chloro-2-(1-oxidopyridin-1-ium-4-carbonyl)phenyl]-3-fluoro-4-morpholin-4-ylbenzenesulfonamide |
| SMILES | O=C(c1cc[n+]([O-])cc1)c1cc(Cl)ccc1NS(=O)(=O)c1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C22H19ClFN3O5S/c23-16-1-3-20(18(13-16)22(28)15-5-7-27(29)8-6-15)25-33(30,31)17-2-4-21(19(24)14-17)26-9-11-32-12-10-26/h1-8,13-14,25H,9-12H2 |
| InChIKey | ORTVKHPKQRZATD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|