C29H23ClN2O4S — CID 17247871
1-benzoyl-N-(2-benzoyl-4-chlorophenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide (PubChem CID 17247871) has the molecular formula C29H23ClN2O4S and a molecular weight of 531.03 g/mol. Its IUPAC name is 1-benzoyl-N-(2-benzoyl-4-chlorophenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide.
| Compound Name | 1-benzoyl-N-(2-benzoyl-4-chlorophenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 17247871 |
| Molecular Formula | C29H23ClN2O4S |
| Molecular Weight | 531.03 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | 1-benzoyl-N-(2-benzoyl-4-chlorophenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide |
| SMILES | O=C(c1ccccc1)c1cc(Cl)ccc1NS(=O)(=O)c1ccc2c(c1)CCCN2C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H23ClN2O4S/c30-23-13-15-26(25(19-23)28(33)20-8-3-1-4-9-20)31-37(35,36)24-14-16-27-22(18-24)12-7-17-32(27)29(34)21-10-5-2-6-11-21/h1-6,8-11,13-16,18-19,31H,7,12,17H2 |
| InChIKey | CTIHJNHXNAKSNW-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.03 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|