C24H23ClN2O3S — CID 17248009
1-(4-chlorobenzoyl)-N-(2-ethylphenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide (PubChem CID 17248009) has the molecular formula C24H23ClN2O3S and a molecular weight of 454.98 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-(2-ethylphenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-(2-ethylphenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 17248009 |
| Molecular Formula | C24H23ClN2O3S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-(2-ethylphenyl)-3,4-dihydro-2H-quinoline-6-sulfonamide |
| SMILES | CCc1ccccc1NS(=O)(=O)c1ccc2c(c1)CCCN2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClN2O3S/c1-2-17-6-3-4-8-22(17)26-31(29,30)21-13-14-23-19(16-21)7-5-15-27(23)24(28)18-9-11-20(25)12-10-18/h3-4,6,8-14,16,26H,2,5,7,15H2,1H3 |
| InChIKey | YGZFIYIHVJITAK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |