C17H17FN2O5S — CID 46292418
3-[(4-fluorophenyl)sulfonylamino]-4-morpholin-4-ylbenzoic acid (PubChem CID 46292418) has the molecular formula C17H17FN2O5S and a molecular weight of 380.40 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)sulfonylamino]-4-morpholin-4-ylbenzoic acid.
| Compound Name | 3-[(4-fluorophenyl)sulfonylamino]-4-morpholin-4-ylbenzoic acid |
|---|---|
| PubChem CID | 46292418 |
| Molecular Formula | C17H17FN2O5S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 3-[(4-fluorophenyl)sulfonylamino]-4-morpholin-4-ylbenzoic acid |
| SMILES | O=C(O)c1ccc(N2CCOCC2)c(NS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H17FN2O5S/c18-13-2-4-14(5-3-13)26(23,24)19-15-11-12(17(21)22)1-6-16(15)20-7-9-25-10-8-20/h1-6,11,19H,7-10H2,(H,21,22) |
| InChIKey | WJEQJOXEZBWVBW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |