C24H21ClF4N4O3S — CID 59788682
N-[4-chloro-2-(pyridine-4-carbonyl)phenyl]-3-fluoro-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenesulfonamide (PubChem CID 59788682) has the molecular formula C24H21ClF4N4O3S and a molecular weight of 556.97 g/mol. Its IUPAC name is N-[4-chloro-2-(pyridine-4-carbonyl)phenyl]-3-fluoro-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenesulfonamide.
| Compound Name | N-[4-chloro-2-(pyridine-4-carbonyl)phenyl]-3-fluoro-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 59788682 |
| Molecular Formula | C24H21ClF4N4O3S |
| Molecular Weight | 556.97 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | N-[4-chloro-2-(pyridine-4-carbonyl)phenyl]-3-fluoro-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenesulfonamide |
| SMILES | O=C(c1ccncc1)c1cc(Cl)ccc1NS(=O)(=O)c1ccc(N2CCN(CC(F)(F)F)CC2)c(F)c1 |
| InChI | InChI=1S/C24H21ClF4N4O3S/c25-17-1-3-21(19(13-17)23(34)16-5-7-30-8-6-16)31-37(35,36)18-2-4-22(20(26)14-18)33-11-9-32(10-12-33)15-24(27,28)29/h1-8,13-14,31H,9-12,15H2 |
| InChIKey | ZDFBQUYRFVGJRI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.97 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|