C18H12Cl2N2O3S — CID 10386667
4-chloro-N-[4-chloro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide (PubChem CID 10386667) has the molecular formula C18H12Cl2N2O3S and a molecular weight of 407.28 g/mol. Its IUPAC name is 4-chloro-N-[4-chloro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[4-chloro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10386667 |
| Molecular Formula | C18H12Cl2N2O3S |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | 4-chloro-N-[4-chloro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide |
| SMILES | O=C(c1cccnc1)c1cc(Cl)ccc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H12Cl2N2O3S/c19-13-3-6-15(7-4-13)26(24,25)22-17-8-5-14(20)10-16(17)18(23)12-2-1-9-21-11-12/h1-11,22H |
| InChIKey | CGOVSCBPOQOMIP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|