C39H27Cl2N5O9S3 — CID 159841678
N-[4-chloro-2-(pyridine-3-carbonyl)phenyl]naphthalene-2-sulfonamide;N-(4-chloro-2-pyridin-3-ylsulfonylphenyl)-4-nitrobenzenesulfonamide (PubChem CID 159841678) has the molecular formula C39H27Cl2N5O9S3 and a molecular weight of 876.78 g/mol. Its IUPAC name is N-[4-chloro-2-(pyridine-3-carbonyl)phenyl]naphthalene-2-sulfonamide;N-(4-chloro-2-pyridin-3-ylsulfonylphenyl)-4-nitrobenzenesulfonamide.
| Compound Name | N-[4-chloro-2-(pyridine-3-carbonyl)phenyl]naphthalene-2-sulfonamide;N-(4-chloro-2-pyridin-3-ylsulfonylphenyl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 159841678 |
| Molecular Formula | C39H27Cl2N5O9S3 |
| Molecular Weight | 876.78 g/mol |
| Exact Mass | 875.03 |
| IUPAC Name | N-[4-chloro-2-(pyridine-3-carbonyl)phenyl]naphthalene-2-sulfonamide;N-(4-chloro-2-pyridin-3-ylsulfonylphenyl)-4-nitrobenzenesulfonamide |
| SMILES | O=C(c1cccnc1)c1cc(Cl)ccc1NS(=O)(=O)c1ccc2ccccc2c1.O=[N+]([O-])c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2S(=O)(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C22H15ClN2O3S.C17H12ClN3O6S2/c23-18-8-10-21(20(13-18)22(26)17-6-3-11-24-14-17)25-29(27,28)19-9-7-15-4-1-2-5-16(15)12-19;18-12-3-8-16(17(10-12)28(24,25)15-2-1-9-19-11-15)20-29(26,27)14-6-4-13(5-7-14)21(22)23/h1-14,25H;1-11,20H |
| InChIKey | NOTHUPDQIPCKIZ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 212.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.78 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|