C19H12BrF3N2O4S — CID 10413664
N-[4-bromo-2-(pyridine-4-carbonyl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 10413664) has the molecular formula C19H12BrF3N2O4S and a molecular weight of 501.28 g/mol. Its IUPAC name is N-[4-bromo-2-(pyridine-4-carbonyl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[4-bromo-2-(pyridine-4-carbonyl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 10413664 |
| Molecular Formula | C19H12BrF3N2O4S |
| Molecular Weight | 501.28 g/mol |
| Exact Mass | 499.97 |
| IUPAC Name | N-[4-bromo-2-(pyridine-4-carbonyl)phenyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=C(c1ccncc1)c1cc(Br)ccc1NS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H12BrF3N2O4S/c20-13-1-6-17(16(11-13)18(26)12-7-9-24-10-8-12)25-30(27,28)15-4-2-14(3-5-15)29-19(21,22)23/h1-11,25H |
| InChIKey | VNMHTSYNIJFYQR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.28 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|