C26H29N3O6S2 — CID 10098884
4-tert-butyl-N-[2-(1-oxidopyridin-1-ium-4-carbonyl)-4-pyrrolidin-1-ylsulfonylphenyl]benzenesulfonamide (PubChem CID 10098884) has the molecular formula C26H29N3O6S2 and a molecular weight of 543.67 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(1-oxidopyridin-1-ium-4-carbonyl)-4-pyrrolidin-1-ylsulfonylphenyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[2-(1-oxidopyridin-1-ium-4-carbonyl)-4-pyrrolidin-1-ylsulfonylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10098884 |
| Molecular Formula | C26H29N3O6S2 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 4-tert-butyl-N-[2-(1-oxidopyridin-1-ium-4-carbonyl)-4-pyrrolidin-1-ylsulfonylphenyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)N3CCCC3)cc2C(=O)c2cc[n+]([O-])cc2)cc1 |
| InChI | InChI=1S/C26H29N3O6S2/c1-26(2,3)20-6-8-21(9-7-20)36(32,33)27-24-11-10-22(37(34,35)29-14-4-5-15-29)18-23(24)25(30)19-12-16-28(31)17-13-19/h6-13,16-18,27H,4-5,14-15H2,1-3H3 |
| InChIKey | PVKHEMVPVVXABS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|