C26H18BrClN2O4S — CID 121041083
N-(2-benzoyl-4-bromophenyl)-2-[(4-chlorophenyl)sulfonylamino]benzamide (PubChem CID 121041083) has the molecular formula C26H18BrClN2O4S and a molecular weight of 569.86 g/mol. Its IUPAC name is N-(2-benzoyl-4-bromophenyl)-2-[(4-chlorophenyl)sulfonylamino]benzamide.
| Compound Name | N-(2-benzoyl-4-bromophenyl)-2-[(4-chlorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121041083 |
| Molecular Formula | C26H18BrClN2O4S |
| Molecular Weight | 569.86 g/mol |
| Exact Mass | 567.99 |
| IUPAC Name | N-(2-benzoyl-4-bromophenyl)-2-[(4-chlorophenyl)sulfonylamino]benzamide |
| SMILES | O=C(Nc1ccc(Br)cc1C(=O)c1ccccc1)c1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H18BrClN2O4S/c27-18-10-15-23(22(16-18)25(31)17-6-2-1-3-7-17)29-26(32)21-8-4-5-9-24(21)30-35(33,34)20-13-11-19(28)12-14-20/h1-16,30H,(H,29,32) |
| InChIKey | XJSLVERZQUDUHK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.86 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |